Solvatochromie-Farbstoff ET(30)

C41H29NO


Drehung:
Stereo:
Bindungen:
Atome:



HUWagner + JBek
LMU München
9.1.2014

Zurück zur Liste
SMILES: [O-]C1=C(C=C(C=C1C1=CC=CC=C1)[N+]1=C(C=C(C=C1C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1)C1=CC=CC=C1
Geometrie: Kristallstruktur X-Ray
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen