(S)-Brom-chlor-fluor-methan

(R)-Brom-chlor-fluor-methan

CHBrClF


(S)/(R)-Brom-chlor-fluor-methan





 
 
 


HUWagner + JBek
LMU München
26.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: [H][C@@](F)(Cl)Br.[H][C@](F)(Cl)Br
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen