(1R,2R)-
1,2-Dibrom-1,2-dichlor-ethan

(1S,2S)-
1,2-Dibrom-1,2-dichlor-ethan

(1S,2R)-
1,2-Dibrom-1,2-dichlor-ethan

= CIP-Nomenklatur

Energetisch günstige C1-C2 gestaffelte Konformationen
 

C2H2Br2Cl2





HUWagner + JBek
LMU München
10.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: Cl[C@H](Br)[C@H](Cl)Br.Cl[C@@H](Br)[C@@H](Cl)Br.Cl[C@@H](Br)[C@H](Cl)Br
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen