Basenpaar G - C
DNA und RNA

Drehung     Stereo
   
Bindungen     Atome
   


Zurück zur Liste
   
 
 
 
 
Drehung     Stereo
   
Bindungen     Atome
   
 
HUWagner + JBek
LMU München
10.7.2013
 
 
   

Basenpaar A - T   DNA
Basenpaar A - U   RNA

Drehung     Stereo
   
Bindungen     Atome
   


Zurück zur Liste
   
 
Drehung     Stereo
   
Bindungen     Atome
   
 
HUWagner + JBek
LMU München
10.7.2013
 
 
   

      SMILES Purine: NC1=NC=NC2=C1N=CN2.NC1=NC2=C(N=CN2)C(=O)N1
      SMILES Pyrimidine: NC1=NC(=O)NC=C1.CC1=CNC(=O)NC1=O.O=C1NC=CC(=O)N1
      Geometrie: A,T,G,C: Kristallstruktur X-Ray, U: H-Atom mit MMD an T angefügt
      Linke Maustaste = Molekül bewegen
      Mittlere Maustaste = Molekül zoomen
      Rechte Maustaste = Jmol Menu