BHT
Butylated hydroxy toluene

C15H24O


Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
28.05.2013


Zurück zur Liste
 
SMILES: Cc1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen