Anthrachinon-Farbstoff

8-Hydroxyrubiadin

C15H10O5

Drehung
Stereo
Bindungen
Atome
Tobias Kirchner

HUWagner + JBek
LMU München
05.03.2014

Zurück zur Liste
SMILES: CC1=C(O)C2=C(C=C1O)C(=O)C1=C(C(O)=CC=C1)C2=O
Geometrie: Quantenchemisch DFT PBE/Def2-SVP Def2-SVP/J-
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen