(5S)-5-Ethenyl-decansäure

(5R)-5-Ethenyl-decansäure

C12H22O2


5-Ethenyl-
decansäuren






HUWagner + JBek
LMU München
26.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CCCCC[C@@H](CCCC(O)=O)C=C.CCCCC[C@H](CCCC(O)=O)C=C
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen