(R)-4-Methyl-cyclohex-1-en
Methyl equatorial - stabiler

(R)-4-Methyl-cyclohex-1-en
Methyl axial - instabiler

C7H12




4-Methyl-cyclohex-1-en


2 Konformere



HUWagner + JBek
LMU München
09.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[C@@H]1CCC=CC1.C[C@@H]1CCC=CC1
Geometrie: Quantenchemisch MP2/6-31G(d,p)
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen