(3S)-3-chlor-2,2-dimethylbutan

(3R)-3-chlor-2,2-dimethylbutan

C6H13Cl


(3S)/(3R)-3-Chlor-
2,2-dimethylbutan







HUWagner + JBek
LMU München
14.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[C@H](Cl)C(C)(C)C.C[C@@H](Cl)C(C)(C)C
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen