s-trans-2,3-Dimethylbuta-1,3-dien

s-cis-2,3-Dimethylbuta-1,3-dien

C6H10


2,3-Dimethyl-
buta-1,3-dien

2 Konformere




HUWagner + JBek
LMU München
16.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC(=C)C(C)=C.CC(=C)C(C)=C
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen