(2S)-2-phenylbutan-2-ol

(2R)-2-phenylbutan-2-ol

C10H14O


2-Phenylbutan-2-ol






HUWagner + JBek
LMU München
16.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC[C@](C)(O)C1=CC=CC=C1.CC[C@@](C)(O)C1=CC=CC=C1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen