beta-Naphthoesäure
Naphthalin-2-carbonsäure

C11H8O2


Drehung
Stereo
Bindungen
Atome


HUWagner + JBek
LMU München
26.06.2013


Zurück zur Liste
 
SMILES: OC(=O)C1=CC2=C(C=CC=C2)C=C1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen