(S)-2-Brombutan

(R)-2-Brombutan

C4H9Br

2-Brombutan




HUWagner + JBek
LMU München
26.04.2015

Zurück zur Liste
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC[C@@H](C)Br.CC[C@H](C)Br
Geometrie: LDA Def2-SVP
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen