(2S,3S)-2-Brom-3-chlor-butan
(2R,3R)-2-Brom-3-chlor-butan

C4H8BrCl


(2S,3S) / (2R,3R)-

2-Brom-3-chlor-butane



 
 
 


HUWagner + JBek
LMU München
01.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[C@H](Cl)[C@H](C)Br.C[C@@H](Cl)[C@@H](C)Br
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen