(1S,2S)-Stilben-epoxid

(1R,2R)-Stilben-epoxid

(1R,2R) / (1S,2S) = meso

C14H12O

Stilben-epoxid
2,3-Diphenyl-oxiran

3 Konfigurations-
isomere


HUWagner + JBek
LMU München
18.07.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: O1[C@H]([C@@H]1c1ccccc1)c1ccccc1.O1[C@@H]([C@H]1c1ccccc1)c1ccccc1.O1[C@@H]([C@@H]1c1ccccc1)c1ccccc1
Geometrie: Molekülmechanik Kraftfeld Dreiding und dann Manipulation
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen