(1S,2S,5S)-2-Ethyl-5-methyl-
cyclohexan-1-ol

C9H18O


Drehung
Stereo
Bindungen
Atome
 

HUWagner + JBek
LMU München
29.05.2013


Zurück zur Liste
 
SMILES: CC[C@H]1CC[C@H](C)C[C@@H]1O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen