1L-chiro-Inositol

C6H12O6

Drehung
Stereo
Bindungen
Atome

HUWagner + JBek
LMU München
22.06.2013


Zurück zur Liste
SMILES: O[C@H]1[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H]1O
Geometrie: Kristallstruktur X-Ray
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen