(1S)-3,4-Dimethylcyclohex-3-en-
1-carbaldehyd

(1R)-3,4-Dimethylcyclohex-3-en-
1-carbaldehyd

C9H14O


3,4-Dimethylcyclohex-3-en-
1-carbaldehyd

2 Enantiomere







HUWagner + JBek
LMU München
18.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: CC1=C(C)C[C@H](CC1)C=O.CC1=C(C)C[C@@H](CC1)C=O
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen