(1S,2S)-1,2-Difluorcyclopentan

(1R,2R)-1,2-Difluorcyclopentan

meso-1,2-Difluorcyclopentan

C5H8F2


3 konfigurations-
isomere
1,2-Difluor-
cyclopentane



HUWagner + JBek
LMU München
01.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: F[C@H]1CCC[C@@H]1F.F[C@@H]1CCC[C@H]1F.F[C@H]1CCC[C@H]1F
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen