meso-1,2-Dibrom-cyclohexan

(1S,2S)-1,2-Dibrom-cyclohexan

(1R,2R)-1,2-Dibrom-cyclohexan

C6H10Br2


3 Konfigurations-
isomere:
1,2-Dibrom-
cyclohexane


Inga Düpont
Katharina Durner
 
HUWagner + JBek
LMU München
02.05.2013
Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: Br[C@H]1CCCC[C@H]1Br.Br[C@H]1CCCC[C@@H]1Br.Br[C@H]1CCCC[C@H]1Br
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen