R,R-1,2-Dimethyl-cyclobutan
S,S-1,2-Dimethyl-cyclobutan
   
R,S / S,R -1,2-Dimethyl-cyclobutan
  = CIP-Nomenklatur




   


  Linke Maustaste
= Molekül bewegen

Mittlere Maustaste
= Molekül zoomen

Rechte Maustaste
= Menu
 
Zurück zur Liste
 

SMILES: C[C@@H]1CC[C@H]1C.C[C@H]1CC[C@@H]1C.C[C@H]1CC[C@H]1C

Geometrie: Molekülmechanik Dreiding Kraftfeld     HUWagner LMU München 02.03.2011