1,4-trans-Dibromcyclohexan
1,4-equatorial - stabiler

1,4-trans-Dibromcyclohexan
1,4-axial - instabiler

C6H10Br2




1,4-trans-Dibrom-cyclohexan





 
 
 


HUWagner + JBek
LMU München
08.05.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: Br[C@H]1CC[C@H](Br)CC1.Br[C@H]1CC[C@H](Br)CC1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen