1-(Diphenylmethyl)-
1,1-dimethylhydrazinium

1-(Diphenylmethyl)-
2,2-dimethylhydrazinium

C15H19N2


1,1-Dimethyl-
benzhydrylium-
Addukte

Herbert Mayr

HUWagner + JBek
LMU München
08.06.2013
 

Zurück zur Liste
 
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 

SMILES: C[N+](C)(N)C(C1=CC=CC=C1)C1=CC=CC=C1.CN(C)[NH2+]C(C1=CC=CC=C1)C1=CC=CC=C1
Geometrie: Molekülmechanik Kraftfeld Dreiding
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen