(1S,2S)-1,2-Diphenyl-ethan-1,2-diol

(1R,2R)-1,2-Diphenyl-ethan-1,2-diol

(1R,2S) = (1S,2R) = meso

C14H14O2

1,2-Diphenyl-
ethan-1,2-diol



HUWagner + JBek
LMU München
17.07.2013

Zurück zur Liste
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
Drehung   Stereo
   
Bindungen   Atome
   
 
Die dargestellte Konformation C1-C2-ekliptisch entspricht der Fischer-Projektion-Konformation.
Die Fischer-Projektion ist zu sehen als Startstellung im 3D-Raum, C1-C2 vorn, Phenyle hinten.
Sie ist energetisch ungünstiger als gestaffelte Konformationen,
wird aber zur Diskusion der Sterochemie verwendet.
 

SMILES: O[C@H]([C@@H](O)c1ccccc1)c1ccccc1.O[C@@H]([C@H](O)c1ccccc1)c1ccccc1.O[C@@H]([C@@H](O)c1ccccc1)c1ccccc1
Geometrie: Molekülmechanik Kraftfeld Dreiding - 1-2-Bindung manuell auf ekliptisch gedreht
Rechte Maustaste = Jmol Menu
Mittlere Maustaste = Molekül zoomen
Linke Maustaste = Molekül bewegen